C26H25F2N3O3 — CID 145306986
methyl (E)-3-[3-fluoro-5-[[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]-hydroxymethyl]-methylamino]phenyl]prop-2-enoate (PubChem CID 145306986) has the molecular formula C26H25F2N3O3 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl (E)-3-[3-fluoro-5-[[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]-hydroxymethyl]-methylamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-fluoro-5-[[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]-hydroxymethyl]-methylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145306986 |
| Molecular Formula | C26H25F2N3O3 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl (E)-3-[3-fluoro-5-[[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]-hydroxymethyl]-methylamino]phenyl]prop-2-enoate |
| SMILES | [H]/N=C/c1cc(-c2ccc(C(O)N(C)c3cc(F)cc(/C=C/C(=O)OC)c3)c(F)c2)ccc1NC |
| InChI | InChI=1S/C26H25F2N3O3/c1-30-24-8-6-17(12-19(24)15-29)18-5-7-22(23(28)13-18)26(33)31(2)21-11-16(10-20(27)14-21)4-9-25(32)34-3/h4-15,26,29-30,33H,1-3H3/b9-4+,29-15+ |
| InChIKey | FCUPHJOZDPUSKG-WRXDWDTBSA-N |
| XLogP | 4.98 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|