C29H41NOS — CID 145342893
(8R,9S,10R,11S,13S,14S)-11-[4-(dimethylamino)phenyl]-3-ethylsulfanyl-3,13-dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 145342893) has the molecular formula C29H41NOS and a molecular weight of 451.72 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-11-[4-(dimethylamino)phenyl]-3-ethylsulfanyl-3,13-dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,11S,13S,14S)-11-[4-(dimethylamino)phenyl]-3-ethylsulfanyl-3,13-dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 145342893 |
| Molecular Formula | C29H41NOS |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-11-[4-(dimethylamino)phenyl]-3-ethylsulfanyl-3,13-dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCSC1(C)C=C2CC[C@@H]3[C@H]([C@@H](c4ccc(N(C)C)cc4)C[C@]4(C)C(=O)CC[C@@H]34)[C@H]2CC1 |
| InChI | InChI=1S/C29H41NOS/c1-6-32-28(2)16-15-22-20(17-28)9-12-23-25-13-14-26(31)29(25,3)18-24(27(22)23)19-7-10-21(11-8-19)30(4)5/h7-8,10-11,17,22-25,27H,6,9,12-16,18H2,1-5H3/t22-,23-,24+,25-,27+,28?,29-/m0/s1 |
| InChIKey | MCLLXFIYPBHSGA-FSHWIEFQSA-N |
| XLogP | 7.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|