C23H40O6 — CID 145368461
2,3,5-trimethoxy-6-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane (PubChem CID 145368461) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2,3,5-trimethoxy-6-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane.
| Compound Name | 2,3,5-trimethoxy-6-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane |
|---|---|
| PubChem CID | 145368461 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2,3,5-trimethoxy-6-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane |
| SMILES | CCC(OC)C(C)C1OC1CC/C=C/C=C(\C)C1OC(OC)C(OC)CC1OC |
| InChI | InChI=1S/C23H40O6/c1-8-17(24-4)16(3)22-18(28-22)13-11-9-10-12-15(2)21-19(25-5)14-20(26-6)23(27-7)29-21/h9-10,12,16-23H,8,11,13-14H2,1-7H3/b10-9+,15-12+ |
| InChIKey | XTKRJRROTCYHOR-MKQCFFQWSA-N |
| XLogP | 3.89 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|