C19H23B — CID 145390195
2,2,3,3-tetramethyl-1-[4-(4-methylphenyl)phenyl]borirane (PubChem CID 145390195) has the molecular formula C19H23B and a molecular weight of 262.20 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1-[4-(4-methylphenyl)phenyl]borirane.
| Compound Name | 2,2,3,3-tetramethyl-1-[4-(4-methylphenyl)phenyl]borirane |
|---|---|
| PubChem CID | 145390195 |
| Molecular Formula | C19H23B |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2,2,3,3-tetramethyl-1-[4-(4-methylphenyl)phenyl]borirane |
| SMILES | Cc1ccc(-c2ccc(B3C(C)(C)C3(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23B/c1-14-6-8-15(9-7-14)16-10-12-17(13-11-16)20-18(2,3)19(20,4)5/h6-13H,1-5H3 |
| InChIKey | YUXCHYXANCPTCS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|