C39H46BN3 — CID 145390238
(4-cyclohexa-1,5-dien-1-ylphenyl)methanamine;4-phenylbenzenecarboximidamide;2,2,3,3-tetramethyl-1-(4-methylphenyl)borirane (PubChem CID 145390238) has the molecular formula C39H46BN3 and a molecular weight of 567.63 g/mol. Its IUPAC name is (4-cyclohexa-1,5-dien-1-ylphenyl)methanamine;4-phenylbenzenecarboximidamide;2,2,3,3-tetramethyl-1-(4-methylphenyl)borirane.
| Compound Name | (4-cyclohexa-1,5-dien-1-ylphenyl)methanamine;4-phenylbenzenecarboximidamide;2,2,3,3-tetramethyl-1-(4-methylphenyl)borirane |
|---|---|
| PubChem CID | 145390238 |
| Molecular Formula | C39H46BN3 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.38 |
| IUPAC Name | (4-cyclohexa-1,5-dien-1-ylphenyl)methanamine;4-phenylbenzenecarboximidamide;2,2,3,3-tetramethyl-1-(4-methylphenyl)borirane |
| SMILES | Cc1ccc(B2C(C)(C)C2(C)C)cc1.NCc1ccc(C2=CCCC=C2)cc1.[H]/N=C(\N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H19B.C13H12N2.C13H15N/c1-10-6-8-11(9-7-10)14-12(2,3)13(14,4)5;14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h6-9H,1-5H3;1-9H,(H3,14,15);2,4-9H,1,3,10,14H2 |
| InChIKey | SHUCIEJFVYSMDR-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|