C20H26F2OS — CID 145418265
tert-butyl-(2,2-difluorobutoxy)-diphenyl-λ4-sulfane (PubChem CID 145418265) has the molecular formula C20H26F2OS and a molecular weight of 352.49 g/mol. Its IUPAC name is tert-butyl-(2,2-difluorobutoxy)-diphenyl-λ4-sulfane.
| Compound Name | tert-butyl-(2,2-difluorobutoxy)-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 145418265 |
| Molecular Formula | C20H26F2OS |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl-(2,2-difluorobutoxy)-diphenyl-λ4-sulfane |
| SMILES | CCC(F)(F)COS(c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H26F2OS/c1-5-20(21,22)16-23-24(19(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15H,5,16H2,1-4H3 |
| InChIKey | QEIHAUXFCHQEIU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |