C16H21N — CID 145430891
4,5-bis(ethenyl)-2-phenyl-2,3-dihydro-1H-pyrrole;ethane (PubChem CID 145430891) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-phenyl-2,3-dihydro-1H-pyrrole;ethane.
| Compound Name | 4,5-bis(ethenyl)-2-phenyl-2,3-dihydro-1H-pyrrole;ethane |
|---|---|
| PubChem CID | 145430891 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4,5-bis(ethenyl)-2-phenyl-2,3-dihydro-1H-pyrrole;ethane |
| SMILES | C=CC1=C(C=C)NC(c2ccccc2)C1.CC |
| InChI | InChI=1S/C14H15N.C2H6/c1-3-11-10-14(15-13(11)4-2)12-8-6-5-7-9-12;1-2/h3-9,14-15H,1-2,10H2;1-2H3 |
| InChIKey | AXIULGGVSXTFHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |