C21H30F6O3 — CID 145487102
2-[(4-ethyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 145487102) has the molecular formula C21H30F6O3 and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-[(4-ethyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-[(4-ethyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 145487102 |
| Molecular Formula | C21H30F6O3 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-[(4-ethyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC1CC(C)C(CC(O)(C(F)(F)F)C(F)(F)F)C1.COC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C12H18F6O.C9H12O2/c1-3-8-4-7(2)9(5-8)6-10(19,11(13,14)15)12(16,17)18;1-11-9(10)8-5-6-2-3-7(8)4-6/h7-9,19H,3-6H2,1-2H3;2-3,6-8H,4-5H2,1H3 |
| InChIKey | MZZHLERXJLUAOL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|