C24H20F6N4O4 — CID 146030486
tert-butyl (NE)-N-[amino-[[3-[2-[3-carbamoyl-4-(trifluoromethyl)phenyl]ethynyl]-5-(trifluoromethyl)benzoyl]amino]methylidene]carbamate (PubChem CID 146030486) has the molecular formula C24H20F6N4O4 and a molecular weight of 542.44 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-[[3-[2-[3-carbamoyl-4-(trifluoromethyl)phenyl]ethynyl]-5-(trifluoromethyl)benzoyl]amino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-[[3-[2-[3-carbamoyl-4-(trifluoromethyl)phenyl]ethynyl]-5-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 146030486 |
| Molecular Formula | C24H20F6N4O4 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | tert-butyl (NE)-N-[amino-[[3-[2-[3-carbamoyl-4-(trifluoromethyl)phenyl]ethynyl]-5-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\N)NC(=O)c1cc(C#Cc2ccc(C(F)(F)F)c(C(N)=O)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F6N4O4/c1-22(2,3)38-21(37)34-20(32)33-19(36)14-8-13(9-15(11-14)23(25,26)27)5-4-12-6-7-17(24(28,29)30)16(10-12)18(31)35/h6-11H,1-3H3,(H2,31,35)(H3,32,33,34,36,37) |
| InChIKey | PMFWMJLZHLNRHC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|