C24H14ClF6N5O3 — CID 155658357
N-chloro-5-[2-[3-(diaminomethylidenecarbamoyl)-5-(trifluoromethyl)phenyl]ethynyl]-N-(5-hydroxy-2-pyridinyl)-2-(trifluoromethyl)benzamide (PubChem CID 155658357) has the molecular formula C24H14ClF6N5O3 and a molecular weight of 569.85 g/mol. Its IUPAC name is N-chloro-5-[2-[3-(diaminomethylidenecarbamoyl)-5-(trifluoromethyl)phenyl]ethynyl]-N-(5-hydroxy-2-pyridinyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-chloro-5-[2-[3-(diaminomethylidenecarbamoyl)-5-(trifluoromethyl)phenyl]ethynyl]-N-(5-hydroxy-2-pyridinyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155658357 |
| Molecular Formula | C24H14ClF6N5O3 |
| Molecular Weight | 569.85 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | N-chloro-5-[2-[3-(diaminomethylidenecarbamoyl)-5-(trifluoromethyl)phenyl]ethynyl]-N-(5-hydroxy-2-pyridinyl)-2-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1cc(C#Cc2ccc(C(F)(F)F)c(C(=O)N(Cl)c3ccc(O)cn3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H14ClF6N5O3/c25-36(19-6-4-16(37)11-34-19)21(39)17-9-12(3-5-18(17)24(29,30)31)1-2-13-7-14(20(38)35-22(32)33)10-15(8-13)23(26,27)28/h3-11,37H,(H4,32,33,35,38) |
| InChIKey | MYTQUSMFTACDMF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|