C26H17F6N3O3 — CID 157074849
N-(5-hydroxy-2-pyridinyl)-5-[2-[3-(3-iminobutanoyl)-5-(trifluoromethyl)phenyl]ethynyl]-2-(trifluoromethyl)benzamide (PubChem CID 157074849) has the molecular formula C26H17F6N3O3 and a molecular weight of 533.43 g/mol. Its IUPAC name is N-(5-hydroxy-2-pyridinyl)-5-[2-[3-(3-iminobutanoyl)-5-(trifluoromethyl)phenyl]ethynyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-(5-hydroxy-2-pyridinyl)-5-[2-[3-(3-iminobutanoyl)-5-(trifluoromethyl)phenyl]ethynyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 157074849 |
| Molecular Formula | C26H17F6N3O3 |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-(5-hydroxy-2-pyridinyl)-5-[2-[3-(3-iminobutanoyl)-5-(trifluoromethyl)phenyl]ethynyl]-2-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\C)CC(=O)c1cc(C#Cc2ccc(C(F)(F)F)c(C(=O)Nc3ccc(O)cn3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17F6N3O3/c1-14(33)8-22(37)17-9-16(10-18(12-17)25(27,28)29)3-2-15-4-6-21(26(30,31)32)20(11-15)24(38)35-23-7-5-19(36)13-34-23/h4-7,9-13,33,36H,8H2,1H3,(H,34,35,38)/b33-14+ |
| InChIKey | LIFNLFNTSHBKCD-ZHSUKTGHSA-N |
| XLogP | 6.09 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|