C28H23F4N5O4 — CID 137380243
tert-butyl N-[N-[3-fluoro-5-[2-[3-(pyridin-2-ylcarbamoyl)-4-(trifluoromethyl)phenyl]ethynyl]benzoyl]carbamimidoyl]carbamate (PubChem CID 137380243) has the molecular formula C28H23F4N5O4 and a molecular weight of 569.52 g/mol. Its IUPAC name is tert-butyl N-[N-[3-fluoro-5-[2-[3-(pyridin-2-ylcarbamoyl)-4-(trifluoromethyl)phenyl]ethynyl]benzoyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[3-fluoro-5-[2-[3-(pyridin-2-ylcarbamoyl)-4-(trifluoromethyl)phenyl]ethynyl]benzoyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 137380243 |
| Molecular Formula | C28H23F4N5O4 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | tert-butyl N-[N-[3-fluoro-5-[2-[3-(pyridin-2-ylcarbamoyl)-4-(trifluoromethyl)phenyl]ethynyl]benzoyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)NC(=O)c1cc(F)cc(C#Cc2ccc(C(F)(F)F)c(C(=O)Nc3ccccn3)c2)c1 |
| InChI | InChI=1S/C28H23F4N5O4/c1-27(2,3)41-26(40)37-25(33)36-23(38)18-12-17(13-19(29)15-18)8-7-16-9-10-21(28(30,31)32)20(14-16)24(39)35-22-6-4-5-11-34-22/h4-6,9-15H,1-3H3,(H,34,35,39)(H3,33,36,37,38,40) |
| InChIKey | SAVRSCHQHQQRGI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|