C18H24N4O2S — CID 146046723
1-[5-[3-(1,3-benzothiazol-2-yl)propyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]ethanol (PubChem CID 146046723) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-[5-[3-(1,3-benzothiazol-2-yl)propyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]ethanol.
| Compound Name | 1-[5-[3-(1,3-benzothiazol-2-yl)propyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 146046723 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[5-[3-(1,3-benzothiazol-2-yl)propyl]-1-(2-ethoxyethyl)-1,2,4-triazol-3-yl]ethanol |
| SMILES | CCOCCn1nc(C(C)O)nc1CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N4O2S/c1-3-24-12-11-22-16(20-18(21-22)13(2)23)9-6-10-17-19-14-7-4-5-8-15(14)25-17/h4-5,7-8,13,23H,3,6,9-12H2,1-2H3 |
| InChIKey | PTYPBRJXQICBJC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|