C19H25N5OS — CID 154823431
2-[5-[4-(1,3-benzothiazol-2-yl)butyl]-1-butyl-1,2,4-triazol-3-yl]acetamide (PubChem CID 154823431) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[5-[4-(1,3-benzothiazol-2-yl)butyl]-1-butyl-1,2,4-triazol-3-yl]acetamide.
| Compound Name | 2-[5-[4-(1,3-benzothiazol-2-yl)butyl]-1-butyl-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 154823431 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[5-[4-(1,3-benzothiazol-2-yl)butyl]-1-butyl-1,2,4-triazol-3-yl]acetamide |
| SMILES | CCCCn1nc(CC(N)=O)nc1CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H25N5OS/c1-2-3-12-24-18(22-17(23-24)13-16(20)25)10-6-7-11-19-21-14-8-4-5-9-15(14)26-19/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H2,20,25) |
| InChIKey | BZVRRDZRZJEKEK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|