C20H24O6 — CID 146116071
(4S)-2-[7-(1,3-benzodioxol-5-yl)heptanoyl]-3,4-dihydroxycyclohex-2-en-1-one (PubChem CID 146116071) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (4S)-2-[7-(1,3-benzodioxol-5-yl)heptanoyl]-3,4-dihydroxycyclohex-2-en-1-one.
| Compound Name | (4S)-2-[7-(1,3-benzodioxol-5-yl)heptanoyl]-3,4-dihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 146116071 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (4S)-2-[7-(1,3-benzodioxol-5-yl)heptanoyl]-3,4-dihydroxycyclohex-2-en-1-one |
| SMILES | O=C(CCCCCCc1ccc2c(c1)OCO2)C1=C(O)[C@@H](O)CCC1=O |
| InChI | InChI=1S/C20H24O6/c21-14(19-15(22)8-9-16(23)20(19)24)6-4-2-1-3-5-13-7-10-17-18(11-13)26-12-25-17/h7,10-11,16,23-24H,1-6,8-9,12H2/t16-/m0/s1 |
| InChIKey | MPCYALYNFCXKLV-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|