C44H27F4NO — CID 146162694
1'-[5,6,7,8-tetrakis(4-fluorophenyl)naphthalen-1-yl]spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 146162694) has the molecular formula C44H27F4NO and a molecular weight of 661.70 g/mol. Its IUPAC name is 1'-[5,6,7,8-tetrakis(4-fluorophenyl)naphthalen-1-yl]spiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 1'-[5,6,7,8-tetrakis(4-fluorophenyl)naphthalen-1-yl]spiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 146162694 |
| Molecular Formula | C44H27F4NO |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 1'-[5,6,7,8-tetrakis(4-fluorophenyl)naphthalen-1-yl]spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | O=C1N(c2cccc3c(-c4ccc(F)cc4)c(-c4ccc(F)cc4)c(-c4ccc(F)cc4)c(-c4ccc(F)cc4)c23)c2ccccc2C12CC2 |
| InChI | InChI=1S/C44H27F4NO/c45-30-16-8-26(9-17-30)38-34-4-3-7-37(49-36-6-2-1-5-35(36)44(24-25-44)43(49)50)42(34)41(29-14-22-33(48)23-15-29)40(28-12-20-32(47)21-13-28)39(38)27-10-18-31(46)19-11-27/h1-23H,24-25H2 |
| InChIKey | UXDICKVCZODPGD-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |