C9H9N3 — CID 146210781
5-cyclohepta-1,3,6-trien-1-yl-1H-1,2,4-triazole (PubChem CID 146210781) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-cyclohepta-1,3,6-trien-1-yl-1H-1,2,4-triazole.
| Compound Name | 5-cyclohepta-1,3,6-trien-1-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 146210781 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 5-cyclohepta-1,3,6-trien-1-yl-1H-1,2,4-triazole |
| SMILES | C1=CCC=CC(c2ncn[nH]2)=C1 |
| InChI | InChI=1S/C9H9N3/c1-2-4-6-8(5-3-1)9-10-7-11-12-9/h1,3-7H,2H2,(H,10,11,12) |
| InChIKey | GKPPMBWIMDQWEX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |