C42H78N2O2 — CID 146293261
2-(dimethylamino)ethyl-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid (PubChem CID 146293261) has the molecular formula C42H78N2O2 and a molecular weight of 643.10 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid.
| Compound Name | 2-(dimethylamino)ethyl-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid |
|---|---|
| PubChem CID | 146293261 |
| Molecular Formula | C42H78N2O2 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.61 |
| IUPAC Name | 2-(dimethylamino)ethyl-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(CCN(C)C)C(=O)O |
| InChI | InChI=1S/C42H78N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(44(42(45)46)40-39-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41H,5-12,17-18,23-40H2,1-4H3,(H,45,46)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | XVAPWNAMHTWJTM-KWXKLSQISA-N |
| XLogP | 13.30 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|