C13H19N3O2S — CID 146312895
4,5-bis(2-methoxyethyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 146312895) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4,5-bis(2-methoxyethyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 4,5-bis(2-methoxyethyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 146312895 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4,5-bis(2-methoxyethyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | COCCc1c(N)cc2sc(N)nc2c1CCOC |
| InChI | InChI=1S/C13H19N3O2S/c1-17-5-3-8-9(4-6-18-2)12-11(7-10(8)14)19-13(15)16-12/h7H,3-6,14H2,1-2H3,(H2,15,16) |
| InChIKey | VEAJCBNGHWTCLQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|