C10H13N3OS — CID 118371301
4-methoxy-6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine (PubChem CID 118371301) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-methoxy-6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine.
| Compound Name | 4-methoxy-6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 118371301 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-methoxy-6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine |
| SMILES | COc1cc(N(C)C)cc2sc(N)nc12 |
| InChI | InChI=1S/C10H13N3OS/c1-13(2)6-4-7(14-3)9-8(5-6)15-10(11)12-9/h4-5H,1-3H3,(H2,11,12) |
| InChIKey | LJRQNAYXDLTCFI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |