C22H26N2O5 — CID 146317602
[1-(2-methylquinolin-6-yl)-2-oxoethyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 146317602) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [1-(2-methylquinolin-6-yl)-2-oxoethyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | [1-(2-methylquinolin-6-yl)-2-oxoethyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 146317602 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [1-(2-methylquinolin-6-yl)-2-oxoethyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)OC(C=O)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C22H26N2O5/c1-6-7-18(24-21(27)29-22(3,4)5)20(26)28-19(13-25)16-10-11-17-15(12-16)9-8-14(2)23-17/h6,8-13,18-19H,1,7H2,2-5H3,(H,24,27) |
| InChIKey | KOMFRPHSBWXJPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|