C12H22N2 — CID 146327140
2-N-[(3Z)-hexa-1,3,5-trien-2-yl]-2-N,3-dimethylbutane-1,2-diamine (PubChem CID 146327140) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-N-[(3Z)-hexa-1,3,5-trien-2-yl]-2-N,3-dimethylbutane-1,2-diamine.
| Compound Name | 2-N-[(3Z)-hexa-1,3,5-trien-2-yl]-2-N,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 146327140 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-N-[(3Z)-hexa-1,3,5-trien-2-yl]-2-N,3-dimethylbutane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)N(C)C(CN)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-6-7-8-11(4)14(5)12(9-13)10(2)3/h6-8,10,12H,1,4,9,13H2,2-3,5H3/b8-7- |
| InChIKey | MYAMZRPBKMCOGC-FPLPWBNLSA-N |
| XLogP | 2.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|