C40H49N9O7 — CID 146396636
8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[4-[[[2-[[(2R)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]octanamide (PubChem CID 146396636) has the molecular formula C40H49N9O7 and a molecular weight of 767.89 g/mol. Its IUPAC name is 8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[4-[[[2-[[(2R)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]octanamide.
| Compound Name | 8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[4-[[[2-[[(2R)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]octanamide |
|---|---|
| PubChem CID | 146396636 |
| Molecular Formula | C40H49N9O7 |
| Molecular Weight | 767.89 g/mol |
| Exact Mass | 767.38 |
| IUPAC Name | 8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[4-[[[2-[[(2R)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]octanamide |
| SMILES | CC[C@H](CO)Nc1nc(NCc2ccc(NC(=O)CCCCCCCOc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C40H49N9O7/c1-4-26(22-50)44-40-46-35(34-36(47-40)48(23-42-34)24(2)3)41-21-25-14-16-27(17-15-25)43-31(51)13-8-6-5-7-9-20-56-30-12-10-11-28-33(30)39(55)49(38(28)54)29-18-19-32(52)45-37(29)53/h10-12,14-17,23-24,26,29,50H,4-9,13,18-22H2,1-3H3,(H,43,51)(H,45,52,53)(H2,41,44,46,47)/t26-,29?/m1/s1 |
| InChIKey | DIMDGWZBOSSHNE-QZWVJJBASA-N |
| XLogP | 4.96 |
| TPSA | 209.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|