C13H28NO4PS — CID 146397069
4-[[(2-methylpropan-2-yl)oxy-(2-methylpropoxy)phosphoryl]sulfanylmethyl]morpholine (PubChem CID 146397069) has the molecular formula C13H28NO4PS and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[[(2-methylpropan-2-yl)oxy-(2-methylpropoxy)phosphoryl]sulfanylmethyl]morpholine.
| Compound Name | 4-[[(2-methylpropan-2-yl)oxy-(2-methylpropoxy)phosphoryl]sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 146397069 |
| Molecular Formula | C13H28NO4PS |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[[(2-methylpropan-2-yl)oxy-(2-methylpropoxy)phosphoryl]sulfanylmethyl]morpholine |
| SMILES | CC(C)COP(=O)(OC(C)(C)C)SCN1CCOCC1 |
| InChI | InChI=1S/C13H28NO4PS/c1-12(2)10-17-19(15,18-13(3,4)5)20-11-14-6-8-16-9-7-14/h12H,6-11H2,1-5H3 |
| InChIKey | ADZXGXIZQOSJKV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|