C9H13N3OS — CID 146411613
(5-amino-1,3,4-thiadiazol-2-yl)-dicyclopropylmethanol (PubChem CID 146411613) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is (5-amino-1,3,4-thiadiazol-2-yl)-dicyclopropylmethanol.
| Compound Name | (5-amino-1,3,4-thiadiazol-2-yl)-dicyclopropylmethanol |
|---|---|
| PubChem CID | 146411613 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5-amino-1,3,4-thiadiazol-2-yl)-dicyclopropylmethanol |
| SMILES | Nc1nnc(C(O)(C2CC2)C2CC2)s1 |
| InChI | InChI=1S/C9H13N3OS/c10-8-12-11-7(14-8)9(13,5-1-2-5)6-3-4-6/h5-6,13H,1-4H2,(H2,10,12) |
| InChIKey | YXLUWQUTUCYJQC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |