C24H38N4O7 — CID 146424852
ditert-butyl 2-[4-[[2-amino-5-(hydroxymethyl)phenyl]methyl]piperazine-1-carbonyl]-2-aminooxypropanedioate (PubChem CID 146424852) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is ditert-butyl 2-[4-[[2-amino-5-(hydroxymethyl)phenyl]methyl]piperazine-1-carbonyl]-2-aminooxypropanedioate.
| Compound Name | ditert-butyl 2-[4-[[2-amino-5-(hydroxymethyl)phenyl]methyl]piperazine-1-carbonyl]-2-aminooxypropanedioate |
|---|---|
| PubChem CID | 146424852 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | ditert-butyl 2-[4-[[2-amino-5-(hydroxymethyl)phenyl]methyl]piperazine-1-carbonyl]-2-aminooxypropanedioate |
| SMILES | CC(C)(C)OC(=O)C(ON)(C(=O)OC(C)(C)C)C(=O)N1CCN(Cc2cc(CO)ccc2N)CC1 |
| InChI | InChI=1S/C24H38N4O7/c1-22(2,3)33-20(31)24(35-26,21(32)34-23(4,5)6)19(30)28-11-9-27(10-12-28)14-17-13-16(15-29)7-8-18(17)25/h7-8,13,29H,9-12,14-15,25-26H2,1-6H3 |
| InChIKey | LLYQIYPWBYUUSR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|