C14H11FINO3S — CID 146442299
2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol (PubChem CID 146442299) has the molecular formula C14H11FINO3S and a molecular weight of 419.22 g/mol. Its IUPAC name is 2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol.
| Compound Name | 2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol |
|---|---|
| PubChem CID | 146442299 |
| Molecular Formula | C14H11FINO3S |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | 2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol |
| SMILES | CN1c2ccccc2C(O)c2cc(F)c(I)cc2S1(=O)=O |
| InChI | InChI=1S/C14H11FINO3S/c1-17-12-5-3-2-4-8(12)14(18)9-6-10(15)11(16)7-13(9)21(17,19)20/h2-7,14,18H,1H3 |
| InChIKey | YEYLGOPMHJWXEA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|