C10H14N2O2 — CID 146450915
2,3-dihydro-1,3-benzoxazole;1,3-oxazolidine (PubChem CID 146450915) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzoxazole;1,3-oxazolidine.
| Compound Name | 2,3-dihydro-1,3-benzoxazole;1,3-oxazolidine |
|---|---|
| PubChem CID | 146450915 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,3-dihydro-1,3-benzoxazole;1,3-oxazolidine |
| SMILES | C1COCN1.c1ccc2c(c1)NCO2 |
| InChI | InChI=1S/C7H7NO.C3H7NO/c1-2-4-7-6(3-1)8-5-9-7;1-2-5-3-4-1/h1-4,8H,5H2;4H,1-3H2 |
| InChIKey | WSUAKJJUEISCKF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |