C13H16O4S — CID 146468830
3,3-bis(ethenoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 146468830) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 3,3-bis(ethenoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-bis(ethenoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 146468830 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3,3-bis(ethenoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | C=COCC1(COC=C)COc2cscc2OC1 |
| InChI | InChI=1S/C13H16O4S/c1-3-14-7-13(8-15-4-2)9-16-11-5-18-6-12(11)17-10-13/h3-6H,1-2,7-10H2 |
| InChIKey | XRGAYJLKWQYVQJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|