C15H26FNO2 — CID 146485986
tert-butyl (3R)-3-(1-fluoropent-4-enyl)-3-methylpyrrolidine-1-carboxylate (PubChem CID 146485986) has the molecular formula C15H26FNO2 and a molecular weight of 271.38 g/mol. Its IUPAC name is tert-butyl (3R)-3-(1-fluoropent-4-enyl)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(1-fluoropent-4-enyl)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146485986 |
| Molecular Formula | C15H26FNO2 |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl (3R)-3-(1-fluoropent-4-enyl)-3-methylpyrrolidine-1-carboxylate |
| SMILES | C=CCCC(F)[C@]1(C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H26FNO2/c1-6-7-8-12(16)15(5)9-10-17(11-15)13(18)19-14(2,3)4/h6,12H,1,7-11H2,2-5H3/t12?,15-/m1/s1 |
| InChIKey | FAUKWWPPTNXLEL-WPZCJLIBSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|