C55H51N — CID 146492826
N-(9,9-dimethylfluoren-2-yl)-4'b,7-dimethyl-N-[4-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]spiro[7,8-dihydrofluorene-9,9'-8aH-fluorene]-2-amine (PubChem CID 146492826) has the molecular formula C55H51N and a molecular weight of 726.02 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-4'b,7-dimethyl-N-[4-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]spiro[7,8-dihydrofluorene-9,9'-8aH-fluorene]-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-4'b,7-dimethyl-N-[4-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]spiro[7,8-dihydrofluorene-9,9'-8aH-fluorene]-2-amine |
|---|---|
| PubChem CID | 146492826 |
| Molecular Formula | C55H51N |
| Molecular Weight | 726.02 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-4'b,7-dimethyl-N-[4-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]spiro[7,8-dihydrofluorene-9,9'-8aH-fluorene]-2-amine |
| SMILES | CC(C)=C/C=C(\C)c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C2(C4=C3C=CC(C)C4)c3ccccc3C3(C)C=CC=CC32)cc1 |
| InChI | InChI=1S/C55H51N/c1-35(2)19-21-37(4)38-22-24-39(25-23-38)56(40-26-29-43-42-14-8-9-15-46(42)53(5,6)49(43)33-40)41-27-30-45-44-28-20-36(3)32-50(44)55(51(45)34-41)48-17-11-10-16-47(48)54(7)31-13-12-18-52(54)55/h8-31,33-34,36,52H,32H2,1-7H3/b37-21+ |
| InChIKey | IIEFOZBOBSOINE-FDALDRLYSA-N |
| XLogP | 14.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.02 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|