C23H20F3N3O3 — CID 146527423
(2S,3R)-2-[(S)-(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-10,11-dihydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-8-one (PubChem CID 146527423) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is (2S,3R)-2-[(S)-(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-10,11-dihydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-8-one.
| Compound Name | (2S,3R)-2-[(S)-(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-10,11-dihydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-8-one |
|---|---|
| PubChem CID | 146527423 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2S,3R)-2-[(S)-(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-10,11-dihydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-8-one |
| SMILES | O=C1C2=C(O)C(O)C=NN2[C@@H]([C@@H](c2ccc(F)cc2)c2ccc(F)cc2F)[C@H]2CCCN12 |
| InChI | InChI=1S/C23H20F3N3O3/c24-13-5-3-12(4-6-13)19(15-8-7-14(25)10-16(15)26)20-17-2-1-9-28(17)23(32)21-22(31)18(30)11-27-29(20)21/h3-8,10-11,17-20,30-31H,1-2,9H2/t17-,18?,19+,20-/m1/s1 |
| InChIKey | ORAWMGJPQLJFJC-ZZQCPNMFSA-N |
| XLogP | 3.04 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |