C10H9N5O3 — CID 146541481
2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzamide (PubChem CID 146541481) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzamide.
| Compound Name | 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 146541481 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H9N5O3/c11-7(16)5-3-1-2-4-6(5)12-8-13-9(17)15-10(18)14-8/h1-4H,(H2,11,16)(H3,12,13,14,15,17,18) |
| InChIKey | OOHQEGYPLMEJKQ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |