C34H41N3O12 — CID 146582336
2-[3,5-bis[2-(3-oxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 9-oxatricyclo[4.3.0.02,8]nonane-4-carboxylate (PubChem CID 146582336) has the molecular formula C34H41N3O12 and a molecular weight of 683.71 g/mol. Its IUPAC name is 2-[3,5-bis[2-(3-oxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 9-oxatricyclo[4.3.0.02,8]nonane-4-carboxylate.
| Compound Name | 2-[3,5-bis[2-(3-oxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 9-oxatricyclo[4.3.0.02,8]nonane-4-carboxylate |
|---|---|
| PubChem CID | 146582336 |
| Molecular Formula | C34H41N3O12 |
| Molecular Weight | 683.71 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 2-[3,5-bis[2-(3-oxatricyclo[3.2.1.02,4]octane-6-carbonyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 9-oxatricyclo[4.3.0.02,8]nonane-4-carboxylate |
| SMILES | O=C(OCCn1c(=O)n(CCOC(=O)C2CC3CC2C2OC32)c(=O)n(CCOC(=O)C2CC3CC2C2OC32)c1=O)C1CC2CC3OC2C3C1 |
| InChI | InChI=1S/C34H41N3O12/c38-29(17-7-14-13-23-22(12-17)24(14)47-23)44-4-1-35-32(41)36(2-5-45-30(39)20-10-15-8-18(20)27-25(15)48-27)34(43)37(33(35)42)3-6-46-31(40)21-11-16-9-19(21)28-26(16)49-28/h14-28H,1-13H2 |
| InChIKey | OCXVFPABFUXMQG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 179.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.71 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|