C25H22N5O6+ — CID 146619597
[(3S,5R)-4-azido-3-benzoyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 146619597) has the molecular formula C25H22N5O6+ and a molecular weight of 488.48 g/mol. Its IUPAC name is [(3S,5R)-4-azido-3-benzoyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(3S,5R)-4-azido-3-benzoyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 146619597 |
| Molecular Formula | C25H22N5O6+ |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [(3S,5R)-4-azido-3-benzoyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | [N-]=[N+]=NC1[C@H](OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)O[C@H]1[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C25H21N5O6/c26-22(31)18-12-7-13-30(14-18)23-20(28-29-27)21(36-25(33)17-10-5-2-6-11-17)19(35-23)15-34-24(32)16-8-3-1-4-9-16/h1-14,19-21,23H,15H2,(H-,26,31)/p+1/t19?,20?,21-,23-/m1/s1 |
| InChIKey | YIHVTCOVWCXKOF-UPSGKMMVSA-O |
| XLogP | 2.73 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|