C7H4ClF4NO2 — CID 14665042
3-chloro-5-(1,1,2,2-tetrafluoroethoxy)-1H-pyridin-2-one (PubChem CID 14665042) has the molecular formula C7H4ClF4NO2 and a molecular weight of 245.56 g/mol. Its IUPAC name is 3-chloro-5-(1,1,2,2-tetrafluoroethoxy)-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-(1,1,2,2-tetrafluoroethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 14665042 |
| Molecular Formula | C7H4ClF4NO2 |
| Molecular Weight | 245.56 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 3-chloro-5-(1,1,2,2-tetrafluoroethoxy)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(OC(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C7H4ClF4NO2/c8-4-1-3(2-13-5(4)14)15-7(11,12)6(9)10/h1-2,6H,(H,13,14) |
| InChIKey | GRGUYBOHANIUQE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|