C12H27Cl2NO — CID 146662628
1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine (PubChem CID 146662628) has the molecular formula C12H27Cl2NO and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine.
| Compound Name | 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 146662628 |
| Molecular Formula | C12H27Cl2NO |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC.OC(CCl)CCl |
| InChI | InChI=1S/C9H21N.C3H6Cl2O/c1-4-7-10(8-5-2)9-6-3;4-1-3(6)2-5/h4-9H2,1-3H3;3,6H,1-2H2 |
| InChIKey | LXUGKYAGNUKUBF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|