About 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine
1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine (PubChem CID 146662628) has the molecular formula C12H27Cl2NO
and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine.
Molecular Properties
| Compound Name | 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine |
| PubChem CID | 146662628 |
| Molecular Formula | C12H27Cl2NO |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC.OC(CCl)CCl |
| InChI | InChI=1S/C9H21N.C3H6Cl2O/c1-4-7-10(8-5-2)9-6-3;4-1-3(6)2-5/h4-9H2,1-3H3;3,6H,1-2H2 |
| InChIKey | LXUGKYAGNUKUBF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine?
The IUPAC name of 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine (CID 146662628) is 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine.
What is the SMILES notation for 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine?
The canonical SMILES for 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine is CCCN(CCC)CCC.OC(CCl)CCl.
What is the InChIKey of 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine?
The InChIKey is LXUGKYAGNUKUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C3H6Cl2O/c1-4-7-10(8-5-2)9-6-3;4-1-3(6)2-5/h4-9H2,1-3H3;3,6H,1-2H2.
What are the key properties of 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine?
1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine has a molecular weight of 272.26 g/mol, XLogP of 3.34, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloropropan-2-ol;N,N-dipropylpropan-1-amine is sourced from PubChem (CID 146662628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).