C7H6N4S2 — CID 146673967
2-methylsulfanyl-8H-pyrimido[4,5-d]pyrimidine-5-thione (PubChem CID 146673967) has the molecular formula C7H6N4S2 and a molecular weight of 210.29 g/mol. Its IUPAC name is 2-methylsulfanyl-8H-pyrimido[4,5-d]pyrimidine-5-thione.
| Compound Name | 2-methylsulfanyl-8H-pyrimido[4,5-d]pyrimidine-5-thione |
|---|---|
| PubChem CID | 146673967 |
| Molecular Formula | C7H6N4S2 |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 2-methylsulfanyl-8H-pyrimido[4,5-d]pyrimidine-5-thione |
| SMILES | CSc1ncc2c(=S)nc[nH]c2n1 |
| InChI | InChI=1S/C7H6N4S2/c1-13-7-8-2-4-5(11-7)9-3-10-6(4)12/h2-3H,1H3,(H,8,9,10,11,12) |
| InChIKey | KHGVGYVQSLHBHK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|