C23H30O5 — CID 146682212
5-(2,5-dihydroxyphenyl)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-ethoxyfuran-2-one (PubChem CID 146682212) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 5-(2,5-dihydroxyphenyl)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-ethoxyfuran-2-one.
| Compound Name | 5-(2,5-dihydroxyphenyl)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-ethoxyfuran-2-one |
|---|---|
| PubChem CID | 146682212 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 5-(2,5-dihydroxyphenyl)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-ethoxyfuran-2-one |
| SMILES | CCOC1(c2cc(O)ccc2O)C=C(CC/C=C(\C)CCC=C(C)C)C(=O)O1 |
| InChI | InChI=1S/C23H30O5/c1-5-27-23(20-14-19(24)12-13-21(20)25)15-18(22(26)28-23)11-7-10-17(4)9-6-8-16(2)3/h8,10,12-15,24-25H,5-7,9,11H2,1-4H3/b17-10+ |
| InChIKey | OEZBWVDBROYJOW-LICLKQGHSA-N |
| XLogP | 5.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|