C42H50O8 — CID 146684389
(3S,4R)-3-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3,3'-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-6-hydroxyspiro[chromene-4,5'-furan]-2,2'-dione (PubChem CID 146684389) has the molecular formula C42H50O8 and a molecular weight of 682.85 g/mol. Its IUPAC name is (3S,4R)-3-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3,3'-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-6-hydroxyspiro[chromene-4,5'-furan]-2,2'-dione.
| Compound Name | (3S,4R)-3-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3,3'-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-6-hydroxyspiro[chromene-4,5'-furan]-2,2'-dione |
|---|---|
| PubChem CID | 146684389 |
| Molecular Formula | C42H50O8 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | (3S,4R)-3-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3,3'-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-6-hydroxyspiro[chromene-4,5'-furan]-2,2'-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@@]2(OC1=O)c1cc(O)ccc1OC(=O)[C@@]2(CC/C=C(\C)CCC=C(C)C)CC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C42H50O8/c1-27(2)11-7-13-29(5)15-9-17-31-25-42(50-39(31)47)35-24-33(44)19-21-38(35)49-40(48)41(42,22-10-16-30(6)14-8-12-28(3)4)26-37(46)34-23-32(43)18-20-36(34)45/h11-12,15-16,18-21,23-25,43-45H,7-10,13-14,17,22,26H2,1-6H3/b29-15+,30-16+/t41-,42-/m1/s1 |
| InChIKey | XZLYASGIHCSKRD-IUZSNSRCSA-N |
| XLogP | 9.61 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|