C24H18Cl2N2O — CID 14676800
5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 14676800) has the molecular formula C24H18Cl2N2O and a molecular weight of 421.33 g/mol. Its IUPAC name is 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 14676800 |
| Molecular Formula | C24H18Cl2N2O |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | Clc1ccc(COc2ccc(C3=Cc4ccccc4C4=NCCN34)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2N2O/c25-19-8-5-18(22(26)14-19)15-29-20-9-6-16(7-10-20)23-13-17-3-1-2-4-21(17)24-27-11-12-28(23)24/h1-10,13-14H,11-12,15H2 |
| InChIKey | WWBSEQJBINIJCZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|