C11H16N2O4 — CID 146865187
(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)methyl 2-methylprop-2-enoate (PubChem CID 146865187) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146865187 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCN1C(=O)N(C)C(=O)C1(C)C |
| InChI | InChI=1S/C11H16N2O4/c1-7(2)8(14)17-6-13-10(16)12(5)9(15)11(13,3)4/h1,6H2,2-5H3 |
| InChIKey | SLSLBPRGOZVWDJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|