C19H14ClO3P — CID 14686914
(3-chlorophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanol (PubChem CID 14686914) has the molecular formula C19H14ClO3P and a molecular weight of 356.75 g/mol. Its IUPAC name is (3-chlorophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanol.
| Compound Name | (3-chlorophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanol |
|---|---|
| PubChem CID | 14686914 |
| Molecular Formula | C19H14ClO3P |
| Molecular Weight | 356.75 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (3-chlorophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanol |
| SMILES | O=P1(C(O)c2cccc(Cl)c2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H14ClO3P/c20-14-7-5-6-13(12-14)19(21)24(22)18-11-4-2-9-16(18)15-8-1-3-10-17(15)23-24/h1-12,19,21H |
| InChIKey | JMMQLJBTECAJAC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|