About 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine
4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine (PubChem CID 14687094) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine.
Analyze 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine?
The IUPAC name of 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine (CID 14687094) is 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine.
What is the SMILES notation for 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine?
The canonical SMILES for 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine is c1ccc2c(c1)OCCc1nncn1-2.
What is the InChIKey of 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine?
The InChIKey is XKWZGXNGIIZAOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c1-2-4-9-8(3-1)13-7-11-12-10(13)5-6-14-9/h1-4,7H,5-6H2.
What are the key properties of 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine?
4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine has a molecular weight of 187.20 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzoxazepine is sourced from PubChem (CID 14687094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).