C14H17BrN2O4 — CID 14687662
(7S,7aS)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium bromide (PubChem CID 14687662) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is (7S,7aS)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium bromide.
| Compound Name | (7S,7aS)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium bromide |
|---|---|
| PubChem CID | 14687662 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (7S,7aS)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium bromide |
| SMILES | C=CC[N+]12COC[C@H]1[C@H](c1ccc([N+](=O)[O-])cc1)OC2.[Br-] |
| InChI | InChI=1S/C14H17N2O4.BrH/c1-2-7-16-9-19-8-13(16)14(20-10-16)11-3-5-12(6-4-11)15(17)18;/h2-6,13-14H,1,7-10H2;1H/q+1;/p-1/t13-,14-,16?;/m0./s1 |
| InChIKey | JDLATBLHFZCXCJ-DBDMLBQMSA-M |
| XLogP | -1.01 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|