C27H32IrN3- — CID 146929051
CID 146929051 (PubChem CID 146929051) has the molecular formula C27H32IrN3- and a molecular weight of 598.84 g/mol.
| Compound Name | CID 146929051 |
|---|---|
| PubChem CID | 146929051 |
| Molecular Formula | C27H32IrN3- |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | — |
| SMILES | [2H]c1[c-]c2c(nc(C(C)(C)C([2H])([2H])[2H])n3c2nc2c([2H])c4c(c([2H])c23)C(C)(C)C(C)(C)C4(C)C)c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C27H32N3.Ir/c1-24(2,3)23-29-19-13-11-10-12-16(19)22-28-20-14-17-18(15-21(20)30(22)23)26(6,7)27(8,9)25(17,4)5;/h10-11,13-15H,1-9H3;/q-1;/i1D3,10D,11D,13D,14D,15D; |
| InChIKey | KHQBQZOTCRBSQQ-XAIBCRBJSA-N |
| XLogP | 6.73 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|