C29H28IrNO- — CID 58224128
9-tert-butyl-11-(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,5,6,7,8,10-hexadeuterio-4H-phenanthro[9,10-d][1,3]oxazol-4-ide;iridium (PubChem CID 58224128) has the molecular formula C29H28IrNO- and a molecular weight of 608.83 g/mol. Its IUPAC name is 9-tert-butyl-11-(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,5,6,7,8,10-hexadeuterio-4H-phenanthro[9,10-d][1,3]oxazol-4-ide;iridium.
| Compound Name | 9-tert-butyl-11-(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,5,6,7,8,10-hexadeuterio-4H-phenanthro[9,10-d][1,3]oxazol-4-ide;iridium |
|---|---|
| PubChem CID | 58224128 |
| Molecular Formula | C29H28IrNO- |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 9-tert-butyl-11-(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,5,6,7,8,10-hexadeuterio-4H-phenanthro[9,10-d][1,3]oxazol-4-ide;iridium |
| SMILES | [2H]c1nc2c3[c-]c([2H])c([2H])c([2H])c3c3c([2H])c(C(C)(C)C)c([2H])c(-c4c([2H])c([2H])c(C(C)(C)C)c([2H])c4[2H])c3c2o1.[Ir] |
| InChI | InChI=1S/C29H28NO.Ir/c1-28(2,3)19-13-11-18(12-14-19)23-15-20(29(4,5)6)16-24-21-9-7-8-10-22(21)26-27(25(23)24)31-17-30-26;/h7-9,11-17H,1-6H3;/q-1;/i7D,8D,9D,11D,12D,13D,14D,15D,16D,17D; |
| InChIKey | HTJJDZXDBICUNT-ASWVZCTISA-N |
| XLogP | 8.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|