About CID 146959366
CID 146959366 (PubChem CID 146959366) has the molecular formula C4H7OY-
and a molecular weight of 160.00 g/mol.
Molecular Properties
| Compound Name | CID 146959366 |
| PubChem CID | 146959366 |
| Molecular Formula | C4H7OY- |
| Molecular Weight | 160.00 g/mol |
| Exact Mass | 159.96 |
| IUPAC Name | — |
| SMILES | CC1(C)[CH-]O1.[Y] |
| InChI | InChI=1S/C4H7O.Y/c1-4(2)3-5-4;/h3H,1-2H3;/q-1; |
| InChIKey | KEXCYSNRHRTBIS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.00 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 146959366 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146959366?
The IUPAC name of CID 146959366 (CID 146959366) is not available.
What is the SMILES notation for CID 146959366?
The canonical SMILES for CID 146959366 is CC1(C)[CH-]O1.[Y].
What is the InChIKey of CID 146959366?
The InChIKey is KEXCYSNRHRTBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O.Y/c1-4(2)3-5-4;/h3H,1-2H3;/q-1;.
What are the key properties of CID 146959366?
CID 146959366 has a molecular weight of 160.00 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146959366 is sourced from PubChem (CID 146959366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).