C17H12BrClFN3O — CID 14698979
1-[bromo-[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 14698979) has the molecular formula C17H12BrClFN3O and a molecular weight of 408.66 g/mol. Its IUPAC name is 1-[bromo-[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[bromo-[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 14698979 |
| Molecular Formula | C17H12BrClFN3O |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 1-[bromo-[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Fc1ccc(C2(C(Br)n3cncn3)OC2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H12BrClFN3O/c18-16(23-10-21-9-22-23)17(11-5-7-12(20)8-6-11)15(24-17)13-3-1-2-4-14(13)19/h1-10,15-16H |
| InChIKey | XSGRCPWKUWRSQS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|