C24H48O8Si2 — CID 14713193
[(Z,4S,5S,6S,7S)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enyl] acetate (PubChem CID 14713193) has the molecular formula C24H48O8Si2 and a molecular weight of 520.81 g/mol. Its IUPAC name is [(Z,4S,5S,6S,7S)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enyl] acetate.
| Compound Name | [(Z,4S,5S,6S,7S)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enyl] acetate |
|---|---|
| PubChem CID | 14713193 |
| Molecular Formula | C24H48O8Si2 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | [(Z,4S,5S,6S,7S)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6,7-dihydroxyoct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)COC(C)=O |
| InChI | InChI=1S/C24H48O8Si2/c1-17(25)29-15-13-14-20(31-33(9,10)23(3,4)5)22(32-34(11,12)24(6,7)8)21(28)19(27)16-30-18(2)26/h13-14,19-22,27-28H,15-16H2,1-12H3/b14-13-/t19-,20-,21-,22+/m0/s1 |
| InChIKey | GJGJYFKQUQOONA-DOUCZOIESA-N |
| XLogP | 4.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|